| 2024-09-24 | When a ray of light passes from a denser to a rarer medium, it bends away from the normal. If we.... | 0:00 | 0 | |
|
| 2024-09-24 | What is the function of a solar cell ? Briefly explain its working and draw its I-V characterist.... | 0:00 | 3 | |
|
| 2024-09-24 | If \\(A\\) is a square matrix of order 3 and \\(|\\mathrm{A}|=5\\), then the value of \\(|2 \\ma.... | 0:00 | 3 | |
|
| 2024-09-24 | Define Lyophobic and Lyophilic sol with a suitable example of each. Why is coagulation of Lyophi.... | 0:00 | 1 | |
|
| 2024-09-24 | Find the particular solution of the differential equation \\(\\frac{d y}{d x}=\\frac{x y}{x^2+y^.... | 0:00 | 2 | |
|
| 2024-09-24 | A planar loop is rotated in a magnetic field about an axis perpendicular to the field. The polar.... | 0:00 | 6 | |
|
| 2024-09-24 | Give an example of oil in water emulsion..... | 0:00 | 1 | |
|
| 2024-09-24 | In Young's double slit experiment, the path difference between two interfering waves at a point .... | 0:00 | 2 | |
|
| 2024-09-24 | Amino acids are.... | 0:00 | 0 | |
|
| 2024-09-24 | Write the products of the following reaction :\n6XeF4+12H2O→\nIs this reaction a dispropor.... | 0:00 | 2 | |
|
| 2024-09-24 | Two nuclei have their mass numbers in the ratio of \\(1: 27\\). What is the ratio of their nucle.... | 0:00 | 2 | |
|
| 2024-09-24 | For a given amplitude modulated wave, the maximum amplitude is 20 V and the minimum amplitude is.... | 0:00 | 0 | | Amplitude
|
| 2024-09-24 | Write the hybridization of \\(\\left[ Fe ( CN )_6\\right]^{3-}\\).(Given : Atomic number of \\(F.... | 0:00 | 1 | |
|
| 2024-09-24 | Find the area of the region lying in the first quadrant and enclosed by the \\(\\mathrm{x}\\) - .... | 0:00 | 1 | |
|
| 2024-09-24 | Which of the following is not true about enantiomers?.... | 0:00 | 2 | |
|
| 2024-09-24 | Define the following terms with a suitable example of each :\n(i) Associated colloids\n(ii) O / .... | 0:00 | 1 | |
|
| 2024-09-24 | A proton and an \\(\\alpha\\) particle are moving with the same speed. Which one of them has gre.... | 0:00 | 2 | |
|
| 2024-09-24 | In what way is diffraction from each slit related to the interference pattern in double slit exp.... | 0:00 | 2 | |
|
| 2024-09-24 | An element with molar mass72gmol-1 forms a cubic unit cell with edge length 400pm. If its densit.... | 0:00 | 5 | |
|
| 2024-09-24 | Find the volume of the parallelopiped whose adjacent edges are represented by \\(2 \\vec{a},-\\v.... | 0:00 | 2 | |
|
| 2024-09-24 | A hydrogen atom makes a transition from \\(n =5\\) to \\(n =1\\) orbit. The wavelength of photon.... | 0:00 | 1 | |
|
| 2024-09-24 | How will you convert:Ethanal to Propan-2-ol.... | 0:00 | 2 | |
|
| 2024-09-24 | Name a carbohydrate present in liver, muscles and brain..... | 0:00 | 1 | |
|
| 2024-09-24 | Two electrons of charge ‘e’ each move in the same circular path of radius ‘r&r.... | 0:00 | 0 | |
|
| 2024-09-24 | Write structures of the products formed when :Propan-2-ol is heated with \\(Cu\\) at \\(573 K\\).... | 0:00 | 3 | |
|
| 2024-09-24 | Define the following terms :\n(i) Oligosaccharides\n(ii) Invert sugar.... | 0:00 | 4 | |
|
| 2024-09-24 | Show that for a first order reaction, time required for completion of \\(99 \\%\\) of reaction i.... | 0:00 | 2 | |
|
| 2024-09-24 | Complete the following reaction and justify that it is a disproportionation reaction :\\[3 MnO _.... | 0:00 | 4 | |
|
| 2024-09-24 | Draw the ray diagram to show use of total internal reflection in(i) optical fiber, and(ii) a pri.... | 0:00 | 6 | |
|
| 2024-09-24 | Zinc, Cadmium and Mercury are quite soft and have low melting points. Explain..... | 0:00 | 2 | |
|
| 2024-09-24 | (a) Why is the collection of white winged moths and dark winged moths made in England between 18.... | 0:00 | 0 | |
|
| 2024-09-24 | Assertion (A): Pt(en)2Cl22+complex is less stable than PtNH34Cl22+ complex.\nReason (R): Pt(en)2.... | 0:00 | 0 | |
|
| 2024-09-24 | The value of \\(\\lambda\\) for which the points \\(A, B\\) and \\(C\\) having position vectors .... | 0:00 | 8 | |
|
| 2024-09-24 | An electron in a hydrogen atom jumps from second excited state to the first excited state. Name .... | 0:00 | 1 | |
|
| 2024-09-24 | The figure shows the energy level diagram of hydrogen atom with few transitions. Which transitio.... | 0:00 | 5 | |
|
| 2024-09-24 | An element with molar mass \\(27 g mol ^{-1}\\) forms a cubic unit cell with edge length \\(300 .... | 0:00 | 5 | |
|
| 2024-09-24 | Which one is responsible for production of energy in bioreaction?.... | 0:00 | 1 | |
|
| 2024-09-24 | How will you convert:Phenol to Picric acid.... | 0:00 | 6 | |
|
| 2024-09-24 | If a unit vector \\(\\vec{a}\\) makes angles \\(\\frac{\\pi}{3}\\) with \\(\\hat{i}, \\frac{\\pi.... | 0:00 | 0 | |
|
| 2024-09-24 | Which of the following physical quantities remain the same for X-ray, red light and radio waves .... | 0:00 | 5 | |
|
| 2024-09-24 | A ray of light falls on a transparent sphere of \\(n=\\sqrt{3}\\) at an angle of incidence \\(60.... | 0:00 | 9 | |
|
| 2024-09-24 | (a) Why do doctors have to carry many tests for selecting a person to be a suitable donor for so.... | 0:00 | 3 | |
|
| 2024-09-24 | Atomic number of Cr and Fe are respectively 24 and 26, which of the following is paramagnetic wi.... | 0:00 | 1 | |
|
| 2024-09-24 | Assertion (A) : All trigonometric functions have their inverses over their respective domains.\n.... | 0:00 | 5 | |
|
| 2024-09-24 | If \\(\\mathrm{A}\\) is a square matrix of order 3 and \\(|\\mathrm{A}|=6\\), then the value of .... | 0:00 | 2 | |
|
| 2024-09-24 | The speed of electromagnetic waves in vacuum is :.... | 0:00 | 3 | |
|
| 2024-09-24 | Assertion (A) :Higher the range of an ammeter, smaller is its resistance.Reason \\((R)\\) :To in.... | 0:00 | 5 | |
|
| 2024-09-24 | What happens in light reaction (photo-chemical reaction) ?.... | 0:00 | 2 | |
|
| 2024-09-24 | Which complex compound will give four isomers?.... | 0:00 | 5 | |
|
| 2024-09-24 | The elements of 3d transition series are given as :Sc Ti V Cr Mn Fe Co Ni Cu ZnAnswer the follow.... | 0:00 | 3 | |
|
| 2024-09-24 | Hydrogen atoms are excited with an electron beam of energy 12.5 eV. Find(a) The highest energy l.... | 0:00 | 0 | |
|
| 2024-09-24 | Briefly explain how energy is released due to proton-proton cycle in the interior of the Sun..... | 0:00 | 1 | |
|
| 2024-09-24 | Assertion: Propanone is more reactive towards nucleophilic addition as compared to propanal.\nRe.... | 0:00 | 3 | |
|
| 2024-09-24 | The function of enzymes in the living system is to:.... | 0:00 | 2 | |
|
| 2024-09-24 | Which of the following represents calcium chlorite?.... | 0:00 | 0 | |
|
| 2024-09-24 | Why is chemistry of actinoids complicated as compared to lanthanoids?.... | 0:00 | 7 | |
|
| 2024-09-24 | Write the truth tables of (i) AND gate and (ii) NOT gate..... | 0:00 | 1 | |
|
| 2024-09-24 | A particle of charge ' q ' and mass ' m ', moving with velocity ' v→ ' is subjected to a u.... | 0:00 | 6 | |
|
| 2024-09-24 | Identify \\(( X )\\) and \\(( Y )\\) in the given 'pie chart'..... | 0:00 | 0 | |
|
| 2024-09-24 | The incorrect statement about denaturation of proteins is :.... | 0:00 | 5 | |
|
| 2024-09-24 | Which of the following fluorides does not exist?.... | 0:00 | 1 | |
|
| 2024-09-24 | Let \\(R\\) be a relation in \\(R\\), the set of all real numbers, defined by \\(R=\\left\\{(a, .... | 0:00 | 9 | |
|
| 2024-09-24 | Draw structure for the polymer used for manufacture of non-stick utensils..... | 0:00 | 1 | |
|
| 2024-09-24 | Why is osmotic pressure of 1 M KCl higher than 1 M urea solution ?.... | 0:00 | 4 | |
|
| 2024-09-24 | Is this representation of the sequence of amino acids indicating a normal human or a sufferer fr.... | 0:00 | 6 | |
|
| 2024-09-24 | Which one of the following is an outer orbital complex and exhibits paramagnetic behaviour?.... | 0:00 | 1 | |
|
| 2024-09-24 | The correct order of decreasing acid strength of trichloroacetic acid (A), trifluoroacetic acid .... | 0:00 | 2 | |
|
| 2024-09-24 | An electron (charge \\(-\\mathrm{e}\\), mass \\(\\mathrm{m}\\) ) is revolving around a positivel.... | 0:00 | 5 | |
|
| 2024-09-24 | If the two plates of the capacitor have + q and – q charges, respectively, find the force .... | 0:00 | 2 | |
|
| 2024-09-24 | In a solution of methylene blue, animal charcoal is added, the solution is then well shaken. Wha.... | 0:00 | 2 | |
|
| 2024-09-24 | The difference between amylose and amylopectin is.... | 0:00 | 2 | |
|
| 2024-09-24 | Which one of the following octahedral complexes will not show geometric isomerism? (A and B are .... | 0:00 | 2 | |
|
| 2024-09-24 | A physician wishes to prepare a buffer solution at pH=3.58, that efficiently resists changes in&.... | 0:00 | 0 | |
|
| 2024-09-24 | A cylindrical conductor of resistance \\(R\\) is connected to a battery. The drift velocity of e.... | 0:00 | 1 | |
|
| 2024-09-24 | Write the principle of working of an ac generator. Derive the expression for the induced em.... | 0:00 | 6 | |
|
| 2024-09-24 | A radioactive substance is reduced to 116th  of its original mass after 4 days. Find the cr.... | 0:00 | 7 | |
|
| 2024-09-24 | For the cell reaction, Cu2+C1aq+Zn(s)⇌Zn2+C2aq+Cu(s) of an electrochemical cell. The chang.... | 0:00 | 1 | |
|
| 2024-09-24 | 4.5 g of aluminium (atomic mass 27 amu) is deposited at cathode from Al3+ solution by a certain .... | 0:00 | 2 | |
|
| 2024-09-24 | At 80°C, distilled water has H3O+concentration equal to 1×10-6 mole L-.... | 0:00 | 8 | |
|
| 2024-09-24 | Two cells, one of emf \\(2 \\mathrm{E}\\) and internal resistance \\(\\mathrm{r}\\) and the othe.... | 0:00 | 0 | |
|
| 2024-09-24 | A cell of emf ‘E’ and internal resistance ‘r’ is connected across a vari.... | 0:00 | 2 | |
|
| 2024-09-24 | There are many phenomena which we observe in nature or at home. For example, raw mangoes shrink .... | 0:00 | 3 | |
|
| 2024-09-24 | Match the interhalogen compounds of Column-I with the geometry in Column-II and assign the corre.... | 0:00 | 2 | |
|
| 2024-09-24 | The number of electrons delivered at the cathode during electrolysis by a current of 1 ampere in.... | 0:00 | 5 | |
|
| 2024-09-24 | Which of the following reagents will be able to distinguish between 1-butyne and 2-butyne?.... | 0:00 | 3 | |
|
| 2024-09-24 | Find the radius of a nucleus with mass number 64 . \\(\\left( R _0=1 \\cdot 2 fm \\right)\\).... | 0:00 | 5 | |
|
| 2024-09-24 | A charge particle is placed between the plates of a charged parallel plate capacitor. It experie.... | 0:00 | 4 | |
|
| 2024-09-24 | Two small identical conducting spheres carrying charge \\(10 \\mu C\\) and \\(-20 \\mu C\\) when.... | 0:00 | 18 | |
|
| 2024-09-24 | An organic compound which produces a bluish green coloured flame on heating in presence of coppe.... | 0:00 | 1 | |
|
| 2024-09-24 | On the basis of the following \(\mathrm{E}^{\circ}\) values, the strongest oxidising agent is:Fe.... | 0:00 | 1 | |
|
| 2024-09-24 | The work done to raise a mass m from the surface of the earth to a height h, which is equal to t.... | 0:00 | 4 | |
|
| 2024-09-24 | Explain the working of an optical fibre. Mention their two important uses..... | 0:00 | 0 | |
|
| 2024-09-24 | Which of the following terms are correct about starch?.... | 0:00 | 3 | |
|
| 2024-09-24 | The ratio of nuclear density of nuclei \\(X ^{27}\\) to \\(Y ^8\\) is.... | 0:00 | 3 | |
|
| 2024-09-24 | Consider the reactions:
(i) CH32CH-CH2Br→C,H,OHCH32CH-CH2OC2H5+HBr(ii) CH32CH-CH2Br→C2.... | 0:00 | 6 | |
|
| 2024-09-24 | The pair of compounds that can exist together is:.... | 0:00 | 1 | |
|
| 2024-09-24 | Give reason for the following:(a) During the electrophilic substitution reaction of haloarenes, .... | 0:00 | 9 | |
|
| 2024-09-24 | Draw the structures of the following derivatives :2,4-DNP of benzaldehyde.... | 0:00 | 0 | |
|
| 2024-09-24 | Carry out the following conversions :Phenol to Anisole.... | 0:00 | 5 | |
|
| 2024-09-24 |  The maximum covalency of nitrogen in N2O5 is : .... | 0:00 | 1 | |
|
