| 2024-10-07 | What is the basic structural difference between glucose and fructose?.... | 0:00 | 12 | |
|
| 2024-10-07 | The IUPAC name for the formula\n.... | 0:00 | 4 | |
|
| 2024-10-07 | Write the final products in the following :\n.... | 0:00 | 2 | |
|
| 2024-10-07 | \n\nElectrical transmission wires which are laid down in winters are stretched tightly to .... | 0:00 | 3 | |
|
| 2024-10-07 | From a lot of 30 bulbs which include 6 defective bulbs, a sample of 2 bulbs is drawn at random o.... | 0:00 | 10 | |
|
| 2024-10-07 | Why is the blue colour of copper sulphate solution slowly discharged when a rod of zinc is dippe.... | 0:00 | 6 | |
|
| 2024-10-07 | An organic compound is adsorbed on the surface of silica gel. Name the process of removing the o.... | 0:00 | 6 | |
|
| 2024-10-07 | Complete the following equations :\n(a) \\(\\quad 2 MnO _4^{-}+5 NO _2^{-}+6 H ^{+} \\longrighta.... | 0:00 | 3 | |
|
| 2024-10-07 | Find the area of the following region using integration :\\[\\left\\{(x, y ): y ^2 \\leq 2 x \\t.... | 0:00 | 8 | |
|
| 2024-10-07 | Write IUPAC name of .... | 0:00 | 4 | |
|
| 2024-10-07 | Pentan-2-one and Pentan-3-one can be distinguished by :.... | 0:00 | 5 | |
|
| 2024-10-07 | The electrical resistance of a column of \\(0.05 mol L ^{-1} NaOH\\) solution of diameter \\(1 c.... | 0:00 | 6 | |
|
| 2024-10-07 | Osmotic pressure of a solution containing \\(3.5 \\mathrm{~g}\\) of dissolved protein in \\(0.05.... | 0:00 | 9 | |
|
| 2024-10-07 | Write chemical equations for the following reactions :Propanone is treated with dilute \\(\\math.... | 0:00 | 8 | |
|
| 2024-10-07 | State Raoult's law for a solution containing volatile components. Write two characteristics of t.... | 0:00 | 5 | |
|
| 2024-10-07 | What happens when D-Glucose is treated with hydroxylamine?.... | 0:00 | 6 | |
|
| 2024-10-07 | Write the main product in the following reactions :\n.... | 0:00 | 6 | |
|
| 2024-10-07 | What is difference between an emulsion and a gel ?.... | 0:00 | 4 | |
|
| 2024-10-07 | Which vitamin deficiency causes :(1) Bone deformities in children?(2) Pernicious anaemia?.... | 0:00 | 1 | |
|
| 2024-10-07 | Why does ammonia readily form a complex whereas ammonium does not?.... | 0:00 | 4 | |
|
| 2024-10-07 | Assertion (A) : Conductivity decreases with decrease in concentration of electrolyte.\nReason (R.... | 0:00 | 3 | |
|
| 2024-10-07 | Assertion (A) : \\(\\mathrm{Zn}, \\mathrm{Cd}\\) and \\(\\mathrm{Hg}\\) are not regarded as tran.... | 0:00 | 1 | |
|
| 2024-10-07 | Identify the dispersed phase and dispersion medium in the following colloids :(a) Fog(b) Milk.... | 0:00 | 7 | |
|
| 2024-10-07 | The following data were obtained during the first order thermal decomposition of \\(C _2 H _5 Cl.... | 0:00 | 6 | |
|
| 2024-10-07 | If \\(y=x^{\\sin x}+\\sin ^{-1} \\sqrt{x}\\), then find \\(\\frac{d y}{d x}\\)..... | 0:00 | 2 | |
|
| 2024-10-07 | Solve the following homogeneous differential equation :\\[x \\frac{d y}{d x}=x+y\\].... | 0:00 | 8 | |
|
| 2024-10-07 | A solution that obeys Raoult's law is called:.... | 0:00 | 3 | |
|
| 2024-10-07 | RNA interference (RNAi) holds great potential as a therapeutic agent for the treatment of human .... | 0:00 | 2 | |
|
| 2024-10-07 | Reduction potentials of 4 metals A, B, C and D are-1.66 V, +0/34 V, +0.80V and -0.76 V . What is.... | 0:00 | 5 | |
|
| 2024-10-05 | An open-ended U-tube of uniform cross-sectional area contains water (density 103 kg m−3). Initia.... | 0:00 | 497 | |
|
| 2024-09-30 | Read the following paragraph and answer the questions that follow.A semiconductor diode is basic.... | 0:00 | 130 | |
|
| 2024-09-30 | In a steady state of heat flow through conduction, the thermal current H (i.e. rate of flow of h.... | 0:00 | 81 | |
|
| 2024-09-30 | Let two objects A and B moving with velocities V→A and V→B  and respe.... | 0:00 | 81 | |
|
| 2024-09-30 | (a) Derive the expression for force per unit length between two long straight parallel current c.... | 0:00 | 65 | |
|
| 2024-09-30 | When electric dipole is placed in uniform electric field, its two charges experience equal and o.... | 0:00 | 70 | |
|
| 2024-09-30 | (a) A parallel plate capacitor is filled by a dielectric whose relative permittivity varies with.... | 0:00 | 38 | |
|
| 2024-09-30 | When p side of p-n junction is connected to positive terminal of battery and n side of p-n junct.... | 0:00 | 29 | |
|
| 2024-09-30 | The nature of physical quantity is described by its dimension. All the physical quantities can b.... | 0:00 | 36 | |
|
| 2024-09-30 | In our daily life experiences, we sometime encounter situations where a force acts on a body for.... | 0:00 | 33 | |
|
| 2024-09-30 | A photodiode is an optoelectronic device in which current carriers are generated by photons thro.... | 0:00 | 35 | |
|
| 2024-09-30 | Whenever an electric current is passed through a conductor, it becomes hot after some time. The .... | 0:00 | 25 | |
|
| 2024-09-30 | Nucleotides and amino acids are vital building blocks in biology, but although nature has master.... | 0:00 | 49 | |
|
| 2024-09-30 | Two charged conducting spheres of radii and are connected to each other by wire. Find the ratio .... | 0:00 | 48 | |
|
| 2024-09-30 | (a) Obtain an expression for work done in an isothermal process.\n(b) A thermodynamic system is .... | 0:00 | 34 | |
|
| 2024-09-29 | eqo120cxyl4imy8lqt97bhvg3.... | 0:00 | 58 | |
|
| 2024-09-29 | Ram was doing an experiment in physics lab to find co-efficient of viscosity of glycerine. In th.... | 0:00 | 23 | | Physics Lab
|
| 2024-09-29 | Pauling introduced the concept of hybridisation. According to him the atomic orbitals combine to.... | 0:00 | 126 | |
|
| 2024-09-29 | (a) By stating sign conventions and assumptions used derive the relation betweenin case of a con.... | 0:00 | 555 | |
|
| 2024-09-29 | Reduction potentials of 4 metals A, B, C and D are-1.66 V, +0/34 V, +0.80V and -0.76 V . What is.... | 0:00 | 55 | |
|
| 2024-09-29 | When an object follows a circular path at a constant speed, the motion of the object is called '.... | 0:00 | 15 | |
|
| 2024-09-29 | Heavy rare earth elements crystallize into hexagonal close packed (h.c.p.) structures and share .... | 0:00 | 14 | |
|
| 2024-09-27 | (a) Answer the following:\n(i) Which cell is used in hearing aids?\n(ii) Which cell was used in .... | 0:00 | 33 | |
|
| 2024-09-27 | (a) Identify the species for which ∆fH° = 0 at 298 K ;&.... | 0:00 | 31 | |
|
| 2024-09-27 | (a) Write IUPAC name of C6H5-CH2-CH2-CH=CH2.\n(b) You are provided with But-2-yne, how will you .... | 0:00 | 22 | |
|
| 2024-09-27 | Account for the following:\n(a) Silver chloride dissolves in excess of Ammonia\n(b) Cuprous chlo.... | 0:00 | 26 | |
|
| 2024-09-27 | (a) Write the formula for the following coordination compound.Bis(ethane-1,2-diamine)dihydroxido.... | 0:00 | 9 | |
|
| 2024-09-27 | For the reversible reaction N2g +3H2g ⇌2NH3g at 500°C, the&#.... | 0:00 | 12 | |
|
| 2024-09-27 | (a) The activation energy of a reaction is 100 kJ/mol . In the presence of catalyst the activati.... | 0:00 | 8 | |
|
| 2024-09-27 | An object \\(A B\\) is kept in front of a composite convex lens, as shown in figure. Will the le.... | 0:00 | 15 | |
|
| 2024-09-27 | The diagram shows four energy level of an electron in Bohr model of hydrogen atom. Identify the .... | 0:00 | 12 | |
|
| 2024-09-27 | The energy of a photon of wavelength \\(\\lambda\\) is.... | 0:00 | 10 | |
|
| 2024-09-27 | A square shaped coil of side \\(10 \\mathrm{~cm}\\), having 100 turns is placed perpendicular to.... | 0:00 | 13 | |
|
| 2024-09-27 | In a Young's double-slit experiment, the screen is moved away from the plane of the slits. What .... | 0:00 | 17 | |
|
| 2024-09-27 | (a) Derive the expression for the magnetic energy stored in an inductor when a current I develop.... | 0:00 | 15 | |
|
| 2024-09-27 | Two long parallel wires kept \\(2 \\mathrm{~m}\\) apart carry \\(3 \\mathrm{~A}\\) current each,.... | 0:00 | 22 | |
|
| 2024-09-27 | What is the effect on the interference fringes in Young's double slit experiment due to each of .... | 0:00 | 4 | |
|
| 2024-09-27 | Show, on a plot, variation of resistivity of (i) a conductor, and (ii) a typical semiconductor a.... | 0:00 | 8 | |
|
| 2024-09-27 | Explain how a potential barrier is developed in a p-n junction diode..... | 0:00 | 5 | |
|
| 2024-09-27 | Explain briefly how a potential barrier is formed in a p-n junction diode..... | 0:00 | 0 | |
|
| 2024-09-27 | A plano convex lens is made of glass of refractive index 1.5. The radius of curvature of the con.... | 0:00 | 3 | |
|
| 2024-09-27 | In a bimolecular reaction, the steric factor P was experimentally determined to be 4.5. the corr.... | 0:00 | 1 | |
|
| 2024-09-27 | (a) Two cells of emf E1 and E2 have their internal resistances r1 and r2, respectively.... | 0:00 | 3 | |
|
| 2024-09-27 | Which of the following is most reactive in nucleophilic addition reactions? .... | 0:00 | 4 | |
|
| 2024-09-27 | A resistance R and a capacitor C are connected in series to a source V=V0sinωt.\nFind :\n(a.... | 0:00 | 4 | | Counter-Strike: Source
|
| 2024-09-27 | Arrange the following acids in the increasing order of their acidic character :\\(\\mathrm{HF}, .... | 0:00 | 1 | |
|
| 2024-09-27 | An organic compound (X) having molecular formula \\(\\mathrm{C}_5 \\mathrm{H}_{10} \\mathrm{O}\\.... | 0:00 | 1 | |
|
| 2024-09-27 | A ray of light is incident at an angle of60° on one face of a prism which has an angle of 3.... | 0:00 | 0 | |
|
| 2024-09-27 | Three resistances \\(1 \\Omega, 2 \\Omega\\) and \\(3 \\Omega\\) are connected to form a triangl.... | 0:00 | 0 | |
|
| 2024-09-27 | The freezing point of a solution containing \\(5 \\mathrm{~g}\\) of benzoic acid \\(\\left(\\mat.... | 0:00 | 1 | |
|
| 2024-09-27 | The half-life period of a radioactive isotope is 20 days. Calculate the time taken for \\(\\frac.... | 0:00 | 1 | |
|
| 2024-09-27 | The value of \\(\\sin ^{-1}\\left(\\cos \\frac{3 \\pi}{5}\\right)\\) is.... | 0:00 | 1 | |
|
| 2024-09-27 | What happens when D-glucose is treated with the following reagents :\n conc. HNO3.... | 0:00 | 0 | |
|
| 2024-09-27 | Assertion (A) : All enzymes are made up of proteins and all proteins have a three-dimensional st.... | 0:00 | 5 | |
|
| 2024-09-27 | How can you convert the following?Phenol to o-hydroxybenzaldehyde..... | 0:00 | 1 | |
|
| 2024-09-27 | Why is chlorobenzene resistant to nucleophilic substitution reaction?.... | 0:00 | 5 | |
|
| 2024-09-27 | Find the unit vector perpendicular to each of the vectors \\(\\vec{a}=4 \\hat{i}+3 \\hat{j}+\\ha.... | 0:00 | 2 | |
|
| 2024-09-27 | How will the rate of the reaction be affected when\n(a) Surface area of the reactant is reduced,.... | 0:00 | 0 | |
|
| 2024-09-27 | Out of alitame, aspartame and sucralose, identify the artificial sweetener with which the contro.... | 0:00 | 1 | |
|
| 2024-09-27 | Why is the use of aspartame limited to cold foods?.... | 0:00 | 1 | |
|
| 2024-09-27 | What are the main constituents of dettol?.... | 0:00 | 0 | |
|
| 2024-09-27 | What happens when aniline is treated with\n\\(\\mathrm{CH}_3 \\mathrm{COCl} /\\) Pyridine?.... | 0:00 | 1 | |
|
| 2024-09-27 | Write the structure of product when D-Glucose reacts with the following :\nConc. \\(\\mathrm{HNO.... | 0:00 | 1 | |
|
| 2024-09-27 | Give reasons for the following :Aquatic animals are more comfortable in cold water in comparison.... | 0:00 | 2 | |
|
| 2024-09-27 | In a p-n junction under equilibrium, there is no net current. Why?.... | 0:00 | 0 | |
|
| 2024-09-27 | Give reasons in two or three sentences only for the following: Phenyl group is known to exert ne.... | 0:00 | 0 | |
|
| 2024-09-27 | What is spectrochemical series? What is the difference between a strong field ligand and a weak .... | 0:00 | 0 | |
|
| 2024-09-27 | Identify X and Y in the following :\n.... | 0:00 | 0 | |
|
| 2024-09-27 | What are the common oxidation states of Cerium (At. no. 58)?.... | 0:00 | 2 | |
|
| 2024-09-27 | What type of deviation from Raoult's law is shown by ethanol and acetone mixture? Give reason..... | 0:00 | 1 | |
|
| 2024-09-27 | For every integer n, let an and bnbe real numbers. Let functionf:R→R be given byf(x)=an+si.... | 0:00 | 1 | |
|
