Write the name of the reaction, structure and IUPAC name of the product formed when (a) phenol r....
Channel:
Subscribers:
456,000
Published on ● Video Link: https://www.youtube.com/watch?v=4E3EKcKGKuM
Write the name of the reaction, structure and IUPAC name of the product formed when (a) phenol reacts with CHCl3in the presence of NaOH followed by hydrolysis. (b) CH3CH2CH(CH3)CH(CH3)CH(CH3)ONa reacts withC2H5Br. 📲PW App Link - https://bit.ly/YTAI_PWAP 🌐PW Website - https://www.pw.live
Other Videos By PW Solutions
2024-08-24 | ysesymk8fmho1hwrmd8jjzd2w.... |
2024-08-24 | yexvdtym80cn6ea0zvry3pek6.... |
2024-08-24 | jhhrkm6kib5x324drbczyq4rx.... |
2024-08-24 | js83zqfqdibnkluvxgrd4y4vd.... |
2024-08-24 | 8xjdecjq7tt8mys5cxwp7l49u.... |
2024-08-24 | maejz04yknded7wm9euw891db.... |
2024-08-24 | aa7f1w91ejtkfsfbo4gzdxfoa.... |
2024-08-24 | mc9kk4u5m78ar6gti74hjuj76.... |
2024-08-24 | 2la00fncspdg2lqg8d99unpq0.... |
2024-08-24 | ijghs8ciz8k36uqkkb12d6u67.... |
2024-08-22 | Write the name of the reaction, structure and IUPAC name of the product formed when (a) phenol r.... |
2024-08-21 | kjx8qagn2d1uk4c0txpynw3i4.... |
2024-08-21 | li7wxub784casgeb2zlxkpews.... |
2024-08-21 | m95mvmyypooyxhc6jx6w1lkqg.... |
2024-08-21 | q88c9mxc071nz7e3prfavyngg.... |
2024-08-21 | vc2dkumx9tddhinuwa232xpz0.... |
2024-08-21 | sy5k0uco1ac2f63zfa52e9zqh.... |
2024-08-21 | wwmnd1n6wbrmlxdtj0x265mbl.... |
2024-08-21 | pfd4wvlshndu9f0zbs652sxoc.... |
2024-08-21 | uonqakuh7oon3bnkjds17k9o5.... |
2024-08-21 | 6tqaoif8c0rfcti53t365i3sd.... |